Difference between revisions of "Cis-cis-D11-23-C42-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-C42-2-ACPs cis-cis-D11-23-C42-2-ACPs] == * common name: ** a cis,cis-delta11,23-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-C42-2-ACPs cis-cis-D11-23-C42-2-ACPs] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
+
* inchi key:
+
** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
+
 
* common name:
 
* common name:
** delphinidin-3-O-β-D-glucoside
+
** a cis,cis-delta11,23-C42:2-[acp]
* molecular weight:
+
** 463.374   
+
 
* Synonym(s):
 
* Synonym(s):
** delfinidin-3-O-glucoside
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8228]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-196]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPK12010278
+
{{#set: common name=a cis,cis-delta11,23-C42:2-[acp]}}
* PUBCHEM:
+
{{#set: produced by=RXN1G-196}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138]
+
* HMDB : HMDB37997
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}}
+
{{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}}
+
{{#set: common name=delphinidin-3-O-β-D-glucoside}}
+
{{#set: molecular weight=463.374    }}
+
{{#set: common name=delfinidin-3-O-glucoside}}
+
{{#set: consumed by=RXN-8228}}
+

Latest revision as of 20:14, 21 March 2018

Metabolite cis-cis-D11-23-C42-2-ACPs

  • common name:
    • a cis,cis-delta11,23-C42:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta11,23-C42:2-[acp" cannot be used as a page name in this wiki.