Difference between revisions of "Cis-cis-D11-23-C42-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-C42-2-ACPs cis-cis-D11-23-C42-2-ACPs] == * common name: ** a cis,cis-delta11,23-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-C42-2-ACPs cis-cis-D11-23-C42-2-ACPs] ==
* smiles:
+
** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
+
* inchi key:
+
** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** preQ1
+
** a cis,cis-delta11,23-C42:2-[acp]
* molecular weight:
+
** 180.189   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-aminomethyl-7-deazaguanine
 
** 7-aminomethyl-7-carbaguanine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1321]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-196]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis,cis-delta11,23-C42:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264]
+
{{#set: produced by=RXN1G-196}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703]
+
{{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}}
+
{{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}}
+
{{#set: common name=preQ1}}
+
{{#set: molecular weight=180.189    }}
+
{{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}}
+
{{#set: consumed by=RXN0-1321}}
+

Latest revision as of 20:14, 21 March 2018

Metabolite cis-cis-D11-23-C42-2-ACPs

  • common name:
    • a cis,cis-delta11,23-C42:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta11,23-C42:2-[acp" cannot be used as a page name in this wiki.