Difference between revisions of "XTP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6640 == * Synonym(s): == Reactions associated == * Reaction: 5-NUCLEOTID-RXN ** Source: orthology-esiliculosus * Reaction: AMP-D...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) | ||
| + | * common name: | ||
| + | ** XTP | ||
| + | * inchi key: | ||
| + | ** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J | ||
| + | * molecular weight: | ||
| + | ** 520.136 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** xanthosine 5' triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN0-1603]] |
| − | * | + | * [[NTPD]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700] |
| + | * HMDB : HMDB00293 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314] | ||
| + | * BIGG : xtp | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622] | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}} | ||
| + | {{#set: common name=XTP}} | ||
| + | {{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}} | ||
| + | {{#set: molecular weight=520.136 }} | ||
| + | {{#set: common name=xanthosine 5' triphosphate}} | ||
| + | {{#set: consumed by=RXN0-1603|NTPD}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite XTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
- common name:
- XTP
- inchi key:
- InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
- molecular weight:
- 520.136
- Synonym(s):
- xanthosine 5' triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.
