Difference between revisions of "R00471"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00471 R00471] == * direction: ** LEFT-TO-RIGHT * common name: ** R63 * Synonym(s): == Reaction Fo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00471 R00471] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** R63 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[D-4-HYDROXY-2-KETO-GLUTARATE]][c] '''=>''' 1.0 [[PYRUVATE]][c] '''+''' 1.0 [[GLYOX]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 (4R)-4-hydroxy-2-oxoglutarate[c] '''=>''' 1.0 pyruvate[c] '''+''' 1.0 glyoxylate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_12620]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=R63}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_12620}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
| + | {{#set: reconstruction tool=pantograph}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Reaction R00471
- direction:
- LEFT-TO-RIGHT
- common name:
- R63
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 D-4-HYDROXY-2-KETO-GLUTARATE[c] => 1.0 PYRUVATE[c] + 1.0 GLYOX[c]
- With common name(s):
- 1.0 (4R)-4-hydroxy-2-oxoglutarate[c] => 1.0 pyruvate[c] + 1.0 glyoxylate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12620
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
