Difference between revisions of "3-KETO-ADIPATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFL FTHFL] == * direction: ** LEFT-TO-RIGHT * common name: ** Formate--tetrahydrofolate ligase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == * smiles: ** C(=O)([O-])CC(=O)CCC(=O)[O-] * common name: ** 3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFL FTHFL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])CC(=O)CCC(=O)[O-]
 
* common name:
 
* common name:
−
** Formate--tetrahydrofolate ligase
+
** 3-oxoadipate
 +
* inchi key:
 +
** InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 158.11   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-ketoadipate
 +
** 3-ketoadipate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[FORMATE]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[THF]][c] '''=>''' 1.0 [[10-FORMYL-THF]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[Pi]][c]
+
* [[3-OXOADIPATE-ENOL-LACTONASE-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 formate[c] '''+''' 1.0 ATP[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''=>''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7582]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* UM-BBD-CPD : c0100
−
{{#set: common name=Formate--tetrahydrofolate ligase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_7582}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459800 5459800]
−
{{#set: in pathway=}}
+
* HMDB : HMDB00398
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00846 C00846]
−
{{#set: reconstruction source=creinhardtii}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573571.html 4573571]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15775 15775]
 +
{{#set: smiles=C(=O)([O-])CC(=O)CCC(=O)[O-]}}
 +
{{#set: common name=3-oxoadipate}}
 +
{{#set: inchi key=InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=158.11    }}
 +
{{#set: common name=β-ketoadipate|3-ketoadipate}}
 +
{{#set: produced by=3-OXOADIPATE-ENOL-LACTONASE-RXN}}

Latest revision as of 21:14, 21 March 2018

Metabolite 3-KETO-ADIPATE

  • smiles:
    • C(=O)([O-])CC(=O)CCC(=O)[O-]
  • common name:
    • 3-oxoadipate
  • inchi key:
    • InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
  • molecular weight:
    • 158.11
  • Synonym(s):
    • β-ketoadipate
    • 3-ketoadipate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC(=O)CCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-KETO-ADIPATE&oldid=47142"