Difference between revisions of "CPD-17815"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16621 RXN-16621] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** 3- | + | ** (11Z)-3-oxo-hexadecenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J |
+ | * molecular weight: | ||
+ | ** 1013.883 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-16561]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16559]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name=3- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021] |
− | + | {{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: | + | {{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}} |
− | {{#set: | + | {{#set: molecular weight=1013.883 }} |
+ | {{#set: consumed by=RXN-16561}} | ||
+ | {{#set: produced by=RXN-16559}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-17815
- smiles:
- CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (11Z)-3-oxo-hexadecenoyl-CoA
- inchi key:
- InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
- molecular weight:
- 1013.883
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.