Difference between revisions of "Tiso gene 4139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Gene == Gene Tiso_gene_4139 == * right end position: ** 3987 * transcription direction: ** POSITIVE * left end position: ** 2802 * centisome position: ** 18.22676...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
+
== Gene Tiso_gene_4139 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 3987
−
* common name:
+
* transcription direction:
−
** ITP
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
+
** 2802
−
* molecular weight:
+
* centisome position:
−
** 504.137    
+
** 18.22676    
 
* Synonym(s):
 
* Synonym(s):
−
** inosine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5073]]
+
* Reaction: [[2.4.1.135-RXN]]
−
* [[ITPP]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[ITUP]]
+
*** Assignment: ec-number
−
* [[RXN0-6382]]
+
== Pathways associated ==
−
* [[ITCY]]
+
* [[PWY-6557]]
−
== Reaction(s) known to produce the compound ==
+
−
* [[ATIDm]]
+
−
* [[ATID]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN-14120]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 132-06-9
+
{{#set: right end position=3987}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439]
+
{{#set: left end position=2802}}
−
* HMDB : HMDB00189
+
{{#set: centisome position=18.22676   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.4.1.135-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081]
+
{{#set: pathway associated=PWY-6557}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402]
+
−
* BIGG : itp
+
−
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: common name=ITP}}
+
−
{{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}}
+
−
{{#set: molecular weight=504.137   }}
+
−
{{#set: common name=inosine triphosphate}}
+
−
{{#set: consumed by=RXN0-5073|ITPP|ITUP|RXN0-6382|ITCY}}
+
−
{{#set: produced by=ATIDm|ATID}}
+
−
{{#set: reversible reaction associated=RXN-14120}}
+

Latest revision as of 21:15, 21 March 2018

Gene Tiso_gene_4139

  • right end position:
    • 3987
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2802
  • centisome position:
    • 18.22676
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4139&oldid=47156"