Difference between revisions of "Trans-D2-cis-cis-D19-31-C50-3-ACPs"

Latest revision as of 21:15, 21 March 2018

"a trans-delta2-cis,cis-delta19,31-C50:3-[acp" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D19-31-C50-3-ACPs trans-D2-cis-cis-D19-31-C50-3-ACPs] ==
-* smiles:
-** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
-* inchi key:
-** InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M
 * common name:
-** tetraiodothyroacetate
+** a trans-delta2-cis,cis-delta19,31-C50:3-[acp]
-* molecular weight:
-** 746.825
 * Synonym(s):
-** Tetrac
-** tetraiodothyroacetic acid
-** TA4
 == Reaction(s) known to consume the compound ==
-* [[RXN-10616]]
+* [[RXN1G-1057]]
-* [[RXN-10617]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a trans-delta2-cis,cis-delta19,31-C50:3-[acp]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272]
+{{#set: consumed by=RXN1G-1057}}
-{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}}
-{{#set: inchi key=InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M}}
-{{#set: common name=tetraiodothyroacetate}}
-{{#set: molecular weight=746.825    }}
-{{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}}
-{{#set: consumed by=RXN-10616|RXN-10617}}