Difference between revisions of "Tiso gene 12533"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12533 == * right end position: ** 6912 * transcription direction: ** POSITIVE * left end position: ** 3857 * centisome position: ** 55.7450...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] ==
+
== Gene Tiso_gene_12533 ==
−
* smiles:
+
* right end position:
−
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
+
** 6912
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
+
** 3857
−
* molecular weight:
+
* centisome position:
−
** 573.426    
+
** 55.74505    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16483]]
+
* Reaction: [[GDR]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GDR_nadp]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GDR_nadp_h]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GDR_nadp_m]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GDRh]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GDRm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[GLUT-REDOX-PWY]]
 +
* [[PWY-4081]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6912}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}}
+
{{#set: left end position=3857}}
−
{{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}}
+
{{#set: centisome position=55.74505    }}
−
{{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
+
{{#set: reaction associated=GDR|GDR_nadp|GDR_nadp_h|GDR_nadp_m|GDRh|GDRm|GLUTATHIONE-REDUCT-NADPH-RXN}}
−
{{#set: molecular weight=573.426    }}
+
{{#set: pathway associated=GLUT-REDOX-PWY|PWY-4081}}
−
{{#set: consumed by=RXN-16483}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_12533

  • right end position:
    • 6912
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3857
  • centisome position:
    • 55.74505
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12533&oldid=47170"