Difference between revisions of "Tiso gene 13737"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13737 == * right end position: ** 5999 * transcription direction: ** POSITIVE * left end position: ** 3302 * centisome position: ** 53.9630...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Gene Tiso_gene_13737 ==
* smiles:
+
* right end position:
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** 5999
* inchi key:
+
* transcription direction:
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
** POSITIVE
* common name:
+
* left end position:
** XXLG xyloglucan oligosaccharide
+
** 3302
* molecular weight:
+
* centisome position:
** 1225.073    
+
** 53.963066    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12398]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=5999}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: left end position=3302}}
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: centisome position=53.963066   }}
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: reaction associated=ATPASE-RXN}}
{{#set: molecular weight=1225.073   }}
+
{{#set: consumed by=RXN-12398}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_13737

  • right end position:
    • 5999
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3302
  • centisome position:
    • 53.963066
  • Synonym(s):

Reactions associated

Pathways associated

External links