Difference between revisions of "Tiso gene 18014"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18014 == * Synonym(s): == Reactions associated == * Reaction: R00476 ** Source: orthology-synechocystis * Reaction: UDPNACETYLMU...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Gene Tiso_gene_18014 ==
* smiles:
+
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
+
* inchi key:
+
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
+
* common name:
+
** apo-4'-lycopenal
+
* molecular weight:
+
** 482.748   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[R00476]]
* [[RXN-11999]]
+
** Source: [[orthology-synechocystis]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6386]]
 +
* [[PWY-6387]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=R00476|UDPNACETYLMURAMATEDEHYDROG-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
+
{{#set: pathway associated=PWY-6386|PWY-6387}}
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
+
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
+
{{#set: common name=apo-4'-lycopenal}}
+
{{#set: molecular weight=482.748    }}
+
{{#set: produced by=RXN-11999}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_18014

  • Synonym(s):

Reactions associated

Pathways associated

External links