Difference between revisions of "CPD-11402"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] == * common name: ** a uridine38-40 in tRNA * Synonym(s)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
 +
* smiles:
 +
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
 
* common name:
 
* common name:
** a uridine38-40 in tRNA
+
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
 +
* inchi key:
 +
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
 +
* molecular weight:
 +
** 826.095   
 
* Synonym(s):
 
* Synonym(s):
** a tRNA uridine38-40
+
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10609]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a uridine38-40 in tRNA}}
+
* PUBCHEM:
{{#set: common name=a tRNA uridine38-40}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
{{#set: consumed by=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
 +
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}}
 +
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
 +
{{#set: molecular weight=826.095    }}
 +
{{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}}
 +
{{#set: produced by=RXN-10609}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-11402

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
  • common name:
    • 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
  • inchi key:
    • InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
  • molecular weight:
    • 826.095
  • Synonym(s):
    • 3,5,3'-triiodothyronine acyl β-D-glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.