Difference between revisions of "CPD-11402"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] == * direction: ** LEFT-TO-RIGHT * common name: ** N,N'-diacetylchitobiose &be...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
 
* common name:
 
* common name:
−
** N,N'-diacetylchitobiose β-N-acetylglucosaminidase
+
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
−
** beta-hexosaminidase
+
* inchi key:
−
* ec number:
+
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
−
** [http://enzyme.expasy.org/EC/3.2.1.52 EC-3.2.1.52]
+
* molecular weight:
 +
** 826.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CHITOBIOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[N-acetyl-D-glucosamine]][c]
+
* [[RXN-10609]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 N,N'-diacetylchitobiose[c] '''+''' 1 H2O[c] '''=>''' 2 N-acetyl-D-glucosamine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1129]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-athaliana]]
+
−
* Gene: [[Tiso_gene_14122]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-7822]], chitin degradation III (Serratia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7822 PWY-7822]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6902]], chitin degradation II (Vibrio): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30674 30674]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
−
* LIGAND-RXN:
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00022 R00022]
+
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
−
{{#set: common name=N,N'-diacetylchitobiose β-N-acetylglucosaminidase}}
+
{{#set: molecular weight=826.095    }}
−
{{#set: common name=beta-hexosaminidase}}
+
{{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}}
−
{{#set: ec number=EC-3.2.1.52}}
+
{{#set: produced by=RXN-10609}}
−
{{#set: gene associated=Tiso_gene_1129|Tiso_gene_14122}}
+
−
{{#set: in pathway=PWY-7822|PWY-6902}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-11402

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
  • common name:
    • 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
  • inchi key:
    • InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
  • molecular weight:
    • 826.095
  • Synonym(s):
    • 3,5,3'-triiodothyronine acyl β-D-glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11402&oldid=47210"