Difference between revisions of "Tiso gene 16302"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
(Created page with "Category:Gene == Gene Tiso_gene_16302 == * right end position: ** 4422 * transcription direction: ** POSITIVE * left end position: ** 2491 * centisome position: ** 55.9147...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
+
== Gene Tiso_gene_16302 ==
* smiles:
+
* right end position:
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
+
** 4422
* inchi key:
+
* transcription direction:
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
+
** POSITIVE
* common name:
+
* left end position:
** geranylgeranyl chlorophyll a
+
** 2491
* molecular weight:
+
* centisome position:
** 886.447    
+
** 55.9147    
 
* Synonym(s):
 
* Synonym(s):
** geranylgeranyl-chl a
 
** GG-chl a
 
** GG-chlorophyll a
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-7664]]
+
* Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
* [[RXN-17428]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
* [[RXN-7663]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=4422}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=2491}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
+
{{#set: centisome position=55.9147   }}
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
+
{{#set: common name=geranylgeranyl chlorophyll a}}
+
{{#set: molecular weight=886.447   }}
+
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
+
{{#set: consumed by=RXN-7664|RXN-17428}}
+
{{#set: produced by=RXN-7663}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_16302

  • right end position:
    • 4422
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2491
  • centisome position:
    • 55.9147
  • Synonym(s):

Reactions associated

Pathways associated

External links