Difference between revisions of "CPD-11412"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17609 RXN-17609] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3)) |
* common name: | * common name: | ||
| − | ** | + | ** triiodothyroacetate ester glucuronide |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M |
| + | * molecular weight: | ||
| + | ** 797.054 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** triiodothyroacetic acid ester glucuronide | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10618]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659348 90659348] | |
| − | {{#set: | + | {{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))}} |
| − | {{#set: | + | {{#set: common name=triiodothyroacetate ester glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=797.054 }} |
| − | {{#set: | + | {{#set: common name=triiodothyroacetic acid ester glucuronide}} |
| − | {{#set: | + | {{#set: produced by=RXN-10618}} |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite CPD-11412
- smiles:
- C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))
- common name:
- triiodothyroacetate ester glucuronide
- inchi key:
- InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M
- molecular weight:
- 797.054
- Synonym(s):
- triiodothyroacetic acid ester glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))" cannot be used as a page name in this wiki.
