Difference between revisions of "Tiso gene 19352"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Gene == Gene Tiso_gene_19352 == * right end position: ** 854 * transcription direction: ** POSITIVE * left end position: ** 124 * centisome position: ** 5.1861143...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19352 == |
− | * | + | * right end position: |
− | ** | + | ** 854 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 124 |
− | * | + | * centisome position: |
− | ** | + | ** 5.1861143 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[R06859]] |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Reaction: [[RXN-11046]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14177]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-9235]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6708]] | ||
+ | * [[PWY-5872]] | ||
+ | * [[PWY-5870]] | ||
+ | * [[PWY-5857]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=854}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=124}} | |
− | + | {{#set: centisome position=5.1861143 }} | |
− | + | {{#set: reaction associated=2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN|R06859|RXN-11046|RXN-14177|RXN-9235}} | |
− | + | {{#set: pathway associated=PWY-6708|PWY-5872|PWY-5870|PWY-5857}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_19352
- right end position:
- 854
- transcription direction:
- POSITIVE
- left end position:
- 124
- centisome position:
- 5.1861143
- Synonym(s):
Reactions associated
- Reaction: 2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN
- Source: orthology-esiliculosus
- Reaction: R06859
- Source: orthology-synechocystis
- Reaction: RXN-11046
- Source: orthology-esiliculosus
- Reaction: RXN-14177
- Source: orthology-athaliana
- Reaction: RXN-9235
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation