Difference between revisions of "Tiso gene 14275"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_14275 == * right end position: ** 2599 * transcription direction: ** POSITIVE * left end position: ** 119 * centisome position: ** 2.072087...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14275 == |
− | * | + | * right end position: |
− | ** | + | ** 2599 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 119 |
− | * | + | * centisome position: |
− | ** | + | ** 2.0720878 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DIOHBUTANONEPSYN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[GTP-CYCLOHYDRO-II-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7539]] | ||
+ | * [[PWY-6167]] | ||
+ | * [[PWY-6168]] | ||
+ | * [[RIBOSYN2-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2599}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=119}} | |
− | + | {{#set: centisome position=2.0720878 }} | |
− | + | {{#set: reaction associated=DIOHBUTANONEPSYN-RXN|GTP-CYCLOHYDRO-II-RXN}} | |
− | + | {{#set: pathway associated=PWY-7539|PWY-6167|PWY-6168|RIBOSYN2-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_14275
- right end position:
- 2599
- transcription direction:
- POSITIVE
- left end position:
- 119
- centisome position:
- 2.0720878
- Synonym(s):
Reactions associated
- Reaction: DIOHBUTANONEPSYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: GTP-CYCLOHYDRO-II-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation