Difference between revisions of "Peptides-holder"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-holder Peptides-holder] == * common name: ** a peptide * Synonym(s): ** peptide == Re...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-holder Peptides-holder] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
 
* common name:
 
* common name:
** 24-methylenecycloartanol
+
** a peptide
* inchi key:
+
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
+
* molecular weight:
+
** 440.751   
+
 
* Synonym(s):
 
* Synonym(s):
** 24(28)-methylenecycloartanol
+
** peptide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.11.9-RXN]]
 +
* [[3.4.16.5-RXN]]
 +
* [[3.4.11.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4021]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 +
* [[3.4.25.1-RXN]]
 +
* [[3.4.24.70-RXN]]
 +
* [[RXN0-3201]]
 +
* [[3.4.11.18-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.21.4-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.24.64-RXN]]
 +
* [[3.4.21.50-RXN]]
 +
* [[3.4.11.14-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.14.9-RXN]]
 +
* [[3.4.11.5-RXN]]
 +
* [[3.4.21.89-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.11.21-RXN]]
 +
* [[3.4.21.112-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.11.9-RXN]]
 +
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 +
* [[3.4.21.83-RXN]]
 +
* [[3.4.24.11-RXN]]
 +
* [[3.4.24.71-RXN]]
 +
* [[3.4.21.107-RXN]]
 +
* [[3.4.16.5-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.22.34-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a peptide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981]
+
{{#set: common name=peptide}}
* LIGAND-CPD:
+
{{#set: consumed by=3.4.11.9-RXN|3.4.16.5-RXN|3.4.11.14-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
+
{{#set: produced by=GAMMA-GLUTAMYLTRANSFERASE-RXN|3.4.25.1-RXN|3.4.24.70-RXN|RXN0-3201|3.4.11.18-RXN|3.4.23.1-RXN|3.4.21.4-RXN|3.4.22.15-RXN|3.4.24.64-RXN|3.4.21.50-RXN|3.4.11.14-RXN|3.4.21.102-RXN|3.4.14.9-RXN|3.4.11.5-RXN|3.4.21.89-RXN|3.4.21.53-RXN|3.4.11.21-RXN|3.4.21.112-RXN|3.4.21.92-RXN|3.4.11.9-RXN|ACYLAMINOACYL-PEPTIDASE-RXN|3.4.21.83-RXN|3.4.24.11-RXN|3.4.24.71-RXN|3.4.21.107-RXN|3.4.16.5-RXN|3.4.22.1-RXN|3.4.22.34-RXN}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: common name=24-methylenecycloartanol}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
+
{{#set: molecular weight=440.751    }}
+
{{#set: common name=24(28)-methylenecycloartanol}}
+
{{#set: produced by=RXN-4021}}
+

Latest revision as of 21:15, 21 March 2018

Metabolite Peptides-holder

  • common name:
    • a peptide
  • Synonym(s):
    • peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links