Difference between revisions of "RXN-13323"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13323 RXN-13323] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13323 RXN-13323] ==
* smiles:
+
* direction:
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
** [http://enzyme.expasy.org/EC/2.5.1.32 EC-2.5.1.32]
* common name:
+
** 14-hydroxylanosterol
+
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-304]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[CPD0-1028]][c] '''<=>''' 1 [[CPD-12321]][c] '''+''' 2 [[PPI]][c]
* [[RXN66-303]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] '''<=>''' 1 15-cis-phytoene[c] '''+''' 2 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15914]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34478 34478]
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R10177 R10177]
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: direction=REVERSIBLE}}
{{#set: molecular weight=442.724    }}
+
{{#set: ec number=EC-2.5.1.32}}
{{#set: common name=4,4-dimethyl-14&alpha;-hydroxymethyl-5&alpha;-cholesta-8,24-dien-3&beta;-ol}}
+
{{#set: gene associated=Tiso_gene_15914}}
{{#set: consumed by=RXN66-304}}
+
{{#set: in pathway=}}
{{#set: produced by=RXN66-303}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 21:15, 21 March 2018

Reaction RXN-13323

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] <=> 1 15-cis-phytoene[c] + 2 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links