Difference between revisions of "S-1-PHENYLETHANOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == * common name: ** an L-cysteine-S-conju...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * smiles: ** CC(O)C1(C=CC=CC=1) * common name: ** (S)-1...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == |
| + | * smiles: | ||
| + | ** CC(O)C1(C=CC=CC=1) | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-1-phenylethanol |
| + | * inchi key: | ||
| + | ** InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N | ||
| + | * molecular weight: | ||
| + | ** 122.166 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-1302]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443135 443135] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.391409.html 391409] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16346 16346] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11348 C11348] | ||
| + | {{#set: smiles=CC(O)C1(C=CC=CC=1)}} | ||
| + | {{#set: common name=(S)-1-phenylethanol}} | ||
| + | {{#set: inchi key=InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N}} | ||
| + | {{#set: molecular weight=122.166 }} | ||
| + | {{#set: reversible reaction associated=RXN-1302}} | ||
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite S-1-PHENYLETHANOL
- smiles:
- CC(O)C1(C=CC=CC=1)
- common name:
- (S)-1-phenylethanol
- inchi key:
- InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N
- molecular weight:
- 122.166
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
