Difference between revisions of "Tiso gene 19933"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12311 CPD-12311] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19933 == * right end position: ** 1430 * transcription direction: ** NEGATIVE * left end position: ** 15 * centisome position: ** 0.7857517...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12311 CPD-12311] ==
+
== Gene Tiso_gene_19933 ==
* smiles:
+
* right end position:
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)C(NC(C)C(=O)[O-])=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C
+
** 1430
* inchi key:
+
* transcription direction:
** InChIKey=SEILTNKQZGHVNR-OTCLWVBASA-L
+
** NEGATIVE
* common name:
+
* left end position:
** a peptidoglycan with D,D cross-link (E. faecium)
+
** 15
* molecular weight:
+
* centisome position:
** 4871.312    
+
** 0.78575176    
 
* Synonym(s):
 
* Synonym(s):
** N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[FUMARATE-REDUCTASE-NADH-RXN]]
* [[RXN-11351]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=1430}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658540 90658540]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)C(NC(C)C(=O)[O-])=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C}}
+
{{#set: left end position=15}}
{{#set: inchi key=InChIKey=SEILTNKQZGHVNR-OTCLWVBASA-L}}
+
{{#set: centisome position=0.78575176   }}
{{#set: common name=a peptidoglycan with D,D cross-link (E. faecium)}}
+
{{#set: reaction associated=FUMARATE-REDUCTASE-NADH-RXN}}
{{#set: molecular weight=4871.312   }}
+
{{#set: common name=N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)}}
+
{{#set: produced by=RXN-11351}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_19933

  • right end position:
    • 1430
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 15
  • centisome position:
    • 0.78575176
  • Synonym(s):

Reactions associated

Pathways associated

External links