Difference between revisions of "ALPHA-RIBAZOLE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** α-ribazole |
+ | * inchi key: | ||
+ | ** InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 278.307 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RIBAZOLEPHOSPHAT-RXN]] |
+ | * [[R04594]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[COBALAMINSYN-RXN]] | ||
+ | * [[RXN-16788]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160433 160433] |
− | {{#set: smiles= | + | * HMDB : HMDB11112 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05775 C05775] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.389646.html 389646] |
− | {{#set: produced by=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10329 10329] | ||
+ | * BIGG : rdmbzi | ||
+ | {{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))}} | ||
+ | {{#set: common name=α-ribazole}} | ||
+ | {{#set: inchi key=InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N}} | ||
+ | {{#set: molecular weight=278.307 }} | ||
+ | {{#set: common name=N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole}} | ||
+ | {{#set: produced by=RIBAZOLEPHOSPHAT-RXN|R04594}} | ||
+ | {{#set: reversible reaction associated=COBALAMINSYN-RXN|RXN-16788}} |
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite ALPHA-RIBAZOLE
- smiles:
- CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))
- common name:
- α-ribazole
- inchi key:
- InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N
- molecular weight:
- 278.307
- Synonym(s):
- N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links