Difference between revisions of "ALPHA-RIBAZOLE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBAMATE-KINASE-RXN CARBAMATE-KINASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://en...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == |
− | * | + | * smiles: |
− | ** | + | ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) |
− | * | + | * common name: |
− | ** | + | ** α-ribazole |
+ | * inchi key: | ||
+ | ** InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N | ||
+ | * molecular weight: | ||
+ | ** 278.307 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RIBAZOLEPHOSPHAT-RXN]] | |
− | + | * [[R04594]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[COBALAMINSYN-RXN]] | |
− | + | * [[RXN-16788]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160433 160433] |
− | * LIGAND- | + | * HMDB : HMDB11112 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05775 C05775] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.389646.html 389646] | |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10329 10329] |
− | + | * BIGG : rdmbzi | |
− | + | {{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))}} | |
− | * | + | {{#set: common name=α-ribazole}} |
− | + | {{#set: inchi key=InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N}} | |
− | + | {{#set: molecular weight=278.307 }} | |
− | + | {{#set: common name=N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole}} | |
− | + | {{#set: produced by=RIBAZOLEPHOSPHAT-RXN|R04594}} | |
− | + | {{#set: reversible reaction associated=COBALAMINSYN-RXN|RXN-16788}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite ALPHA-RIBAZOLE
- smiles:
- CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))
- common name:
- α-ribazole
- inchi key:
- InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N
- molecular weight:
- 278.307
- Synonym(s):
- N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links