Difference between revisions of "R369"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R369 R369] == * direction: ** REVERSIBLE * common name: ** R369 * Synonym(s): == Reaction Formula...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R369 R369] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** R369 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1.0 [[Octadec-2-enoyl-ACPs]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] '''<=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[Stearoyl-ACPs]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1.0 a trans-octadec-2-enoyl-[acp][c] '''+''' 1.0 H+[c] '''+''' 1.0 NADPH[c] '''<=>''' 1.0 NADP+[c] '''+''' 1.0 a stearoyl-[acp][c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_10778]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=R369}} | |
| − | + | {{#set: gene associated=Tiso_gene_10778}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-synechocystis}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:15, 21 March 2018
Contents
Reaction R369
- direction:
- REVERSIBLE
- common name:
- R369
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 Octadec-2-enoyl-ACPs[c] + 1.0 PROTON[c] + 1.0 NADPH[c] <=> 1.0 NADP[c] + 1.0 Stearoyl-ACPs[c]
- With common name(s):
- 1.0 a trans-octadec-2-enoyl-[acp][c] + 1.0 H+[c] + 1.0 NADPH[c] <=> 1.0 NADP+[c] + 1.0 a stearoyl-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10778
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
