Difference between revisions of "Tiso gene 18270"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Gene == Gene Tiso_gene_18270 == * Synonym(s): == Reactions associated == * Reaction: RXN-14570 ** Source: orthology-esiliculosus == Pathways associated =...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18270 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[RXN-14570]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | * [[ | + | == Pathways associated == |
| − | == | + | * [[PWY0-1587]] |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-14570}} | |
| − | + | {{#set: pathway associated=PWY0-1587}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_18270
- Synonym(s):
Reactions associated
- Reaction: RXN-14570
- Source: orthology-esiliculosus
