Difference between revisions of "3Z-PHYCOERYTHROBILIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6081 RXN-6081] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6081 RXN-6081] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
 +
* common name:
 +
** (3Z)-phycoerythrobilin
 +
* inchi key:
 +
** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
 +
* molecular weight:
 +
** 584.671   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[2-ACETO-LACTATE]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DIACETYL]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[Donor-H2]][c]
+
* [[1.3.7.3-RXN]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 (S)-2-acetolactate[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 H+[c] '''=>''' 1 diacetyl[c] '''+''' 1 CO2[c] '''+''' 1 a reduced electron acceptor[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-6389]], (S)-acetoin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6389 PWY-6389]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-5938]], (R)-acetoin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=PWY-6389|PWY-5938}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182]
{{#set: reconstruction category=annotation}}
+
* CHEBI:
{{#set: reconstruction source=annotation-experimental_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438]
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
 +
{{#set: common name=(3Z)-phycoerythrobilin}}
 +
{{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}}
 +
{{#set: molecular weight=584.671    }}
 +
{{#set: produced by=1.3.7.3-RXN}}

Latest revision as of 20:15, 21 March 2018

Metabolite 3Z-PHYCOERYTHROBILIN

  • smiles:
    • CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
  • common name:
    • (3Z)-phycoerythrobilin
  • inchi key:
    • InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
  • molecular weight:
    • 584.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.