Difference between revisions of "3Z-PHYCOERYTHROBILIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6442 CPD-6442] == * smiles: ** COC(C1(C=CC=CC=1O))=O * inchi key: ** InChIKey=OSWPMRLSEDHDF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (3Z)-phycoerythrobilin |
+ | * inchi key: | ||
+ | ** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 584.671 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.3.7.3-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438] |
− | + | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | |
− | {{#set: smiles= | + | {{#set: common name=(3Z)-phycoerythrobilin}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}} |
− | {{#set: | + | {{#set: molecular weight=584.671 }} |
− | {{#set: molecular weight= | + | {{#set: produced by=1.3.7.3-RXN}} |
− | {{#set: | + | |
− | + |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite 3Z-PHYCOERYTHROBILIN
- smiles:
- CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- common name:
- (3Z)-phycoerythrobilin
- inchi key:
- InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
- molecular weight:
- 584.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.