Difference between revisions of "Tiso gene 8816"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_8816 == * right end position: ** 9275 * transcription direction: ** POSITIVE * left end position: ** 8275 * centisome position: ** 83.93346...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8816 == |
− | * | + | * right end position: |
− | ** | + | ** 9275 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 8275 |
− | * | + | * centisome position: |
− | ** | + | ** 83.933464 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.2.1.78-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
+ | * [[PWY-7456]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9275}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=8275}} | |
− | + | {{#set: centisome position=83.933464 }} | |
− | + | {{#set: reaction associated=3.2.1.78-RXN}} | |
− | + | {{#set: pathway associated=PWY-7456}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_8816
- right end position:
- 9275
- transcription direction:
- POSITIVE
- left end position:
- 8275
- centisome position:
- 83.933464
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.78-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation