Difference between revisions of "RNA-Holder"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Holder RNA-Holder] == * common name: ** RNA * Synonym(s): == Reaction(s) known to consume...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Holder RNA-Holder] ==
* smiles:
+
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
+
 
* common name:
 
* common name:
** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
+
** RNA
* inchi key:
+
** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
+
* molecular weight:
+
** 573.426   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16483]]
+
* [[3.1.27.1-RXN]]
 +
* [[RME294]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RME256]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=RNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214]
+
{{#set: consumed by=3.1.27.1-RXN|RME294}}
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}}
+
{{#set: produced by=RME256}}
{{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
+
{{#set: reversible reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
{{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}}
+
{{#set: molecular weight=573.426    }}
+
{{#set: consumed by=RXN-16483}}
+

Latest revision as of 21:15, 21 March 2018

Metabolite RNA-Holder

  • common name:
    • RNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links