Difference between revisions of "Tiso gene 11786"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
(Created page with "Category:Gene == Gene Tiso_gene_11786 == * right end position: ** 2838 * transcription direction: ** NEGATIVE * left end position: ** 822 * centisome position: ** 10.92068...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
+
== Gene Tiso_gene_11786 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
+
** 2838
−
* common name:
+
* transcription direction:
−
** Mg-protoporphyrin
+
** NEGATIVE
−
* molecular weight:
+
* left end position:
−
** 582.94    
+
** 822
 +
* centisome position:
 +
** 10.920686    
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin IX
 
−
** magnesium protoporphyrin
 
−
** MgP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN1F-20]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2838}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=822}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
+
{{#set: centisome position=10.920686    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
+
−
{{#set: common name=Mg-protoporphyrin}}
+
−
{{#set: molecular weight=582.94    }}
+
−
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
+
−
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+
−
{{#set: produced by=RXN1F-20}}
+

Latest revision as of 21:16, 21 March 2018

Gene Tiso_gene_11786

  • right end position:
    • 2838
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 822
  • centisome position:
    • 10.920686
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11786&oldid=47305"