Difference between revisions of "Tiso gene 1131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1131 == * right end position: ** 22185 * transcription direction: ** NEGATIVE * left end position: ** 21286 * centisome position: ** 82.347...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Gene Tiso_gene_1131 ==
−
* smiles:
+
* right end position:
−
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** 22185
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
** 21286
−
* molecular weight:
+
* centisome position:
−
** 262.262    
+
** 82.34748    
 
* Synonym(s):
 
* Synonym(s):
−
** salicyl-HCH
 
−
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 
−
** acylsaligenin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12252]]
+
* Reaction: [[2.7.1.68-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* CAS : 529507-98-0
+
{{#set: right end position=22185}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: left end position=21286}}
−
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: centisome position=82.34748   }}
−
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: reaction associated=2.7.1.68-RXN}}
−
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
{{#set: molecular weight=262.262   }}
+
−
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
−
{{#set: consumed by=RXN-12252}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_1131

  • right end position:
    • 22185
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 21286
  • centisome position:
    • 82.34748
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1131&oldid=47340"