Difference between revisions of "CPD-13174"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R163-RXN R163-RXN] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * common name:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R163-RXN R163-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
 +
* common name:
 +
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
 +
* inchi key:
 +
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 262.262   
 
* Synonym(s):
 
* Synonym(s):
 +
** salicyl-HCH
 +
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 +
** acylsaligenin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12252]]
−
** 1 [[WATER]][c] '''+''' 1 [[PAPS]][c] '''<=>''' 1 [[APS]][c] '''+''' 1 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''<=>''' 1 adenosine 5'-phosphosulfate[c] '''+''' 1 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12601]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 529507-98-0
−
** [http://www.genome.jp/dbget-bin/www_bget?R00508 R00508]
+
* PUBCHEM:
−
{{#set: direction=REVERSIBLE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
−
{{#set: gene associated=Tiso_gene_12601}}
+
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
−
{{#set: in pathway=}}
+
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=262.262    }}
−
{{#set: reconstruction source=creinhardtii|esiliculosus|athaliana}}
+
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
 +
{{#set: consumed by=RXN-12252}}

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-13174

  • smiles:
    • C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
  • common name:
    • salicyl-6-hydroxy-2-cyclohexene-on-oyl
  • inchi key:
    • InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
  • molecular weight:
    • 262.262
  • Synonym(s):
    • salicyl-HCH
    • 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
    • acylsaligenin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13174&oldid=47342"