Difference between revisions of "Tiso gene 12592"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...")
(Created page with "Category:Gene == Gene Tiso_gene_12592 == * right end position: ** 3644 * transcription direction: ** NEGATIVE * left end position: ** 86 * centisome position: ** 1.2560246...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] ==
+
== Gene Tiso_gene_12592 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
+
** 3644
−
* common name:
+
* transcription direction:
−
** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
+
** NEGATIVE
−
* molecular weight:
+
* left end position:
−
** 611.959    
+
** 86
 +
* centisome position:
 +
** 1.2560246    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5284]]
+
* Reaction: [[ARGSUCCINSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-5283]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-10]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-4984]]
 +
* [[PWY-5]]
 +
* [[ARGSYN-PWY]]
 +
* [[PWY-5154]]
 +
* [[ARGSYNBSUB-PWY]]
 +
* [[PWY-4983]]
 +
* [[PWY-7400]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3644}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=86}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490]
+
{{#set: centisome position=1.2560246   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ARGSUCCINSYN-RXN|RXN-10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830]
+
{{#set: pathway associated=PWY-4984|PWY-5|ARGSYN-PWY|PWY-5154|ARGSYNBSUB-PWY|PWY-4983|PWY-7400}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=611.959   }}
+
−
{{#set: consumed by=RXN-5284}}
+
−
{{#set: produced by=RXN-5283}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_12592

  • right end position:
    • 3644
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 86
  • centisome position:
    • 1.2560246
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12592&oldid=47343"