Difference between revisions of "OCTAPRENYL-METHOXY-BENZOQUINONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-FeS-cluster-proteins Apo-FeS-cluster-proteins] == * common name: ** an apo-iron-sulfur prot...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] == * smiles: ** CC(=CCCC(=CCCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol |
+ | * inchi key: | ||
+ | ** InChIKey=CZFRMASEEPTBAQ-MYCGWMCTSA-N | ||
+ | * molecular weight: | ||
+ | ** 685.084 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-octaprenyl-6-methoxy-benzene-1,4-diol | ||
+ | ** 2-octaprenyl-6-methoxyhydroquinone | ||
+ | ** 2-octaprenyl-6-methoxyquinol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60655 60655] | ||
+ | * BIGG : 2ombzl | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852329 49852329] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C}} | ||
+ | {{#set: common name=2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol}} | ||
+ | {{#set: inchi key=InChIKey=CZFRMASEEPTBAQ-MYCGWMCTSA-N}} | ||
+ | {{#set: molecular weight=685.084 }} | ||
+ | {{#set: common name=2-octaprenyl-6-methoxy-benzene-1,4-diol|2-octaprenyl-6-methoxyhydroquinone|2-octaprenyl-6-methoxyquinol}} | ||
+ | {{#set: consumed by=2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN}} |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C
- common name:
- 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol
- inchi key:
- InChIKey=CZFRMASEEPTBAQ-MYCGWMCTSA-N
- molecular weight:
- 685.084
- Synonym(s):
- 2-octaprenyl-6-methoxy-benzene-1,4-diol
- 2-octaprenyl-6-methoxyhydroquinone
- 2-octaprenyl-6-methoxyquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links