Difference between revisions of "Tiso gene 14086"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14086 == * right end position: ** 3123 * transcription direction: ** POSITIVE * left end position: ** 2082 * centisome position: ** 35.5411...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14086 == |
− | * | + | * right end position: |
− | ** | + | ** 3123 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2082 |
− | * | + | * centisome position: |
− | ** | + | ** 35.54114 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3123}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2082}} | |
− | + | {{#set: centisome position=35.54114 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:16, 21 March 2018
Gene Tiso_gene_14086
- right end position:
- 3123
- transcription direction:
- POSITIVE
- left end position:
- 2082
- centisome position:
- 35.54114
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation