Difference between revisions of "CPD-13008"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15815 RXN-15815] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O |
| + | * common name: | ||
| + | ** 3',5'-diiodothyronine | ||
| + | * inchi key: | ||
| + | ** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N | ||
| + | * molecular weight: | ||
| + | ** 525.081 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3',5'-diiodo-L-thyronine | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12037]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088] |
| − | {{#set: | + | {{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}} |
| − | {{#set: | + | {{#set: common name=3',5'-diiodothyronine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}} |
| + | {{#set: molecular weight=525.081 }} | ||
| + | {{#set: common name=3',5'-diiodo-L-thyronine}} | ||
| + | {{#set: consumed by=RXN-12037}} | ||
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite CPD-13008
- smiles:
- C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
- common name:
- 3',5'-diiodothyronine
- inchi key:
- InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
- molecular weight:
- 525.081
- Synonym(s):
- 3',5'-diiodo-L-thyronine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.
