Difference between revisions of "L-THREONINE-O-3-PHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=orDCh orDCh] == * direction: ** LEFT-TO-RIGHT * common name: ** ornithine decarboxylase, chloroplas...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * smiles: ** CC(OP([O-])([O-])=O)C([N+]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(OP([O-])([O-])=O)C([N+])C([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** L-threonine 3-O-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L | ||
+ | * molecular weight: | ||
+ | ** 197.084 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** O-phospho-L-threonine | ||
+ | ** phosphothreonine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8626]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 1114-81-4 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171] |
− | {{#set: | + | * HMDB : HMDB11185 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12147 C12147] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675] | ||
+ | * BIGG : thrp | ||
+ | {{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}} | ||
+ | {{#set: common name=L-threonine 3-O-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L}} | ||
+ | {{#set: molecular weight=197.084 }} | ||
+ | {{#set: common name=O-phospho-L-threonine|phosphothreonine}} | ||
+ | {{#set: produced by=RXN-8626}} |
Latest revision as of 21:16, 21 March 2018
Contents
Metabolite L-THREONINE-O-3-PHOSPHATE
- smiles:
- CC(OP([O-])([O-])=O)C([N+])C([O-])=O
- common name:
- L-threonine 3-O-phosphate
- inchi key:
- InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L
- molecular weight:
- 197.084
- Synonym(s):
- O-phospho-L-threonine
- phosphothreonine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OP([O-])([O-])=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.