Difference between revisions of "CPD-14283"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14283 CPD-14283] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14283 CPD-14283] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-cerot-2-enoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=GGUUXBBWTGIIGE-KESUDTCVSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1140.167 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trans-2,3-dihydro-cerotenoyl-CoA |
| + | ** (2E)-cerotenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13309]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13305]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581195 71581195] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74281 74281] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | |
| − | {{#set: smiles=C( | + | {{#set: common name=trans-cerot-2-enoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GGUUXBBWTGIIGE-KESUDTCVSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=1140.167 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=trans-2,3-dihydro-cerotenoyl-CoA|(2E)-cerotenoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-13309}} |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-13305}} |
| − | {{#set: | + | |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite CPD-14283
- smiles:
- CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- common name:
- trans-cerot-2-enoyl-CoA
- inchi key:
- InChIKey=GGUUXBBWTGIIGE-KESUDTCVSA-J
- molecular weight:
- 1140.167
- Synonym(s):
- trans-2,3-dihydro-cerotenoyl-CoA
- (2E)-cerotenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
