Difference between revisions of "AMINO-OXOBUT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogena...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] == * smiles: ** CC(=O)C([N+])C([O-])=O * common name: ** L-2-amino-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)C([N+])C([O-])=O
 
* common name:
 
* common name:
−
** alcohol dehydrogenase (ethanol, NADP), chloroplast
+
** L-2-amino-3-oxobutanoate
 +
* inchi key:
 +
** InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N
 +
* molecular weight:
 +
** 117.104   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxothreonine
 +
** 3-keto-L-threonine
 +
** L-2-amino-acetoacetate
 +
** L-2-amino-3-ketobutyrate
 +
** L-2-amino-3-oxobutyrate
 +
** α-amino-β-ketobutyrate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[THREOSPON-RXN]]
−
** 1.0 [[ACETALD]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[ETOH]][h] '''+''' 1.0 [[NADP]][h]
+
* [[AKBLIG-RXN]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1.0 acetaldehyde[h] '''+''' 1.0 H+[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 ethanol[h] '''+''' 1.0 NADP+[h]
+
* [[RXN-16000]]
−
 
+
* [[THREODEHYD-RXN]]
−
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14126]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=alcohol dehydrogenase (ethanol, NADP), chloroplast}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289686 86289686]
−
{{#set: gene associated=Tiso_gene_14126}}
+
* HMDB : HMDB06454
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03508 C03508]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.chemspider.com/Chemical-Structure.4573764.html 4573764]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78948 78948]
 +
* BIGG : 2aobut
 +
{{#set: smiles=CC(=O)C([N+])C([O-])=O}}
 +
{{#set: common name=L-2-amino-3-oxobutanoate}}
 +
{{#set: inchi key=InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N}}
 +
{{#set: molecular weight=117.104    }}
 +
{{#set: common name=3-oxothreonine|3-keto-L-threonine|L-2-amino-acetoacetate|L-2-amino-3-ketobutyrate|L-2-amino-3-oxobutyrate|α-amino-β-ketobutyrate}}
 +
{{#set: consumed by=THREOSPON-RXN|AKBLIG-RXN}}
 +
{{#set: produced by=RXN-16000|THREODEHYD-RXN}}

Latest revision as of 20:16, 21 March 2018

Metabolite AMINO-OXOBUT

  • smiles:
    • CC(=O)C([N+])C([O-])=O
  • common name:
    • L-2-amino-3-oxobutanoate
  • inchi key:
    • InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N
  • molecular weight:
    • 117.104
  • Synonym(s):
    • 3-oxothreonine
    • 3-keto-L-threonine
    • L-2-amino-acetoacetate
    • L-2-amino-3-ketobutyrate
    • L-2-amino-3-oxobutyrate
    • α-amino-β-ketobutyrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=AMINO-OXOBUT&oldid=47414"