Difference between revisions of "CPD0-2472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17853 RXN-17853] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17853 RXN-17853] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/2.3.1.bt EC-2.3.1.bt]
+
** (R)-NADHX
 +
* inchi key:
 +
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
 +
* molecular weight:
 +
** 681.445   
 
* Synonym(s):
 
* Synonym(s):
 +
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[L-methionyl-L-glutamyl-Protein]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[N-Ac-L-methionyl-L-glutamyl-Protein]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-12754]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 an N-terminal-L-methionyl-L-glutamyl-[protein][c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 an N-terminal Nα-acetyl-L-methionyl-L-glutamyl-[protein][c] '''+''' 1 coenzyme A[c] '''+''' 1 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
+
** '''21''' reactions found over '''21''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1.bt}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
{{#set: in pathway=PWY-7800}}
+
* CHEBI:
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=(R)-NADHX}}
 +
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
 +
{{#set: molecular weight=681.445    }}
 +
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
 +
{{#set: produced by=RXN-12754}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD0-2472

  • smiles:
    • C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
  • common name:
    • (R)-NADHX
  • inchi key:
    • InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
  • molecular weight:
    • 681.445
  • Synonym(s):
    • (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)" cannot be used as a page name in this wiki.