Difference between revisions of "METHYLENE-THF"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENE-THF METHYLENE-THF] == * smiles: ** C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENE-THF METHYLENE-THF] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34))) |
* common name: | * common name: | ||
| − | ** | + | ** 5,10-methylenetetrahydropteroyl mono-L-glutamate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QYNUQALWYRSVHF-OLZOCXBDSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 455.429 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N5,N10-methylenetetrahydrofolate mono-L-glutamate |
| − | ** | + | ** 5,10-methylenetetrahydrofolate mono-L-glutamate |
| − | ** | + | ** 5,10-methylene-H4PteGlu1 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MTMOHT]] |
| + | * [[MTHFO]] | ||
| + | * [[MTHFO_nadp]] | ||
| + | * [[R01226]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[MTHFor_nadp]] | ||
| + | * [[MLTHFtm]] | ||
| + | * [[R01220]] | ||
== External links == | == External links == | ||
| − | * | + | * BIGG : mlthf |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548565 9548565] |
| − | {{#set: smiles=C( | + | * HMDB : HMDB01533 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00143 C00143] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.7827491.html 7827491] |
| − | {{#set: consumed by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15636 15636] | ||
| + | * METABOLIGHTS : MTBLC15636 | ||
| + | {{#set: smiles=C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))}} | ||
| + | {{#set: common name=5,10-methylenetetrahydropteroyl mono-L-glutamate}} | ||
| + | {{#set: inchi key=InChIKey=QYNUQALWYRSVHF-OLZOCXBDSA-L}} | ||
| + | {{#set: molecular weight=455.429 }} | ||
| + | {{#set: common name=N5,N10-methylenetetrahydrofolate mono-L-glutamate|5,10-methylenetetrahydrofolate mono-L-glutamate|5,10-methylene-H4PteGlu1}} | ||
| + | {{#set: consumed by=MTMOHT|MTHFO|MTHFO_nadp|R01226}} | ||
| + | {{#set: reversible reaction associated=MTHFor_nadp|MLTHFtm|R01220}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite METHYLENE-THF
- smiles:
- C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))
- common name:
- 5,10-methylenetetrahydropteroyl mono-L-glutamate
- inchi key:
- InChIKey=QYNUQALWYRSVHF-OLZOCXBDSA-L
- molecular weight:
- 455.429
- Synonym(s):
- N5,N10-methylenetetrahydrofolate mono-L-glutamate
- 5,10-methylenetetrahydrofolate mono-L-glutamate
- 5,10-methylene-H4PteGlu1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : mlthf
- PUBCHEM:
- HMDB : HMDB01533
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15636
"C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))" cannot be used as a page name in this wiki.
