Difference between revisions of "RXN-7968"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7968 RXN-7968] == * direction: ** LEFT-TO-RIGHT * common name: ** pentafunctional_protein * ec...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7968 RXN-7968] ==
* smiles:
+
* direction:
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
+
 
* common name:
 
* common name:
** adenosine 5'-phosphoselenate
+
** pentafunctional_protein
* molecular weight:
+
* ec number:
** 473.174   
+
** [http://enzyme.expasy.org/EC/1.1.1.282 EC-1.1.1.282]
 
* Synonym(s):
 
* Synonym(s):
** adenylyl-selenate
 
** APSe
 
** adenosine phosphoselenate
 
** adenylylselenate
 
** adenosine-5'-phosphoselenate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12720]]
+
** 1 [[SHIKIMATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-DEHYDRO-SHIKIMATE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 shikimate[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 H+[c] '''+''' 1 3-dehydroshikimate[c] '''+''' 1 NAD(P)H[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5752]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5753]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17744 17744]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
{{#set: common name=pentafunctional_protein}}
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.282}}
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
{{#set: gene associated=Tiso_gene_5752|Tiso_gene_5753}}
* HMDB : HMDB04112
+
{{#set: in pathway=PWY-6163}}
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: common name=adenosine 5'-phosphoselenate}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: molecular weight=473.174    }}
+
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
{{#set: produced by=RXN-12720}}
+

Latest revision as of 20:17, 21 March 2018

Reaction RXN-7968

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • pentafunctional_protein
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links