Difference between revisions of "CPD-13713"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5087 == * Synonym(s): == Reactions associated == * RIBITOL-2-DEHYDROGENASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == |
| + | * smiles: | ||
| + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O | ||
| + | * common name: | ||
| + | ** adenosine 5'-phosphoselenate | ||
| + | * inchi key: | ||
| + | ** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M | ||
| + | * molecular weight: | ||
| + | ** 473.174 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** adenylyl-selenate | ||
| + | ** APSe | ||
| + | ** adenosine phosphoselenate | ||
| + | ** adenylylselenate | ||
| + | ** adenosine-5'-phosphoselenate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-12720]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723] |
| + | * HMDB : HMDB04112 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686] | ||
| + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}} | ||
| + | {{#set: common name=adenosine 5'-phosphoselenate}} | ||
| + | {{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}} | ||
| + | {{#set: molecular weight=473.174 }} | ||
| + | {{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}} | ||
| + | {{#set: produced by=RXN-12720}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-13713
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
- common name:
- adenosine 5'-phosphoselenate
- inchi key:
- InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
- molecular weight:
- 473.174
- Synonym(s):
- adenylyl-selenate
- APSe
- adenosine phosphoselenate
- adenylylselenate
- adenosine-5'-phosphoselenate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O" cannot be used as a page name in this wiki.
