Difference between revisions of "Tiso gene 13367"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)CO * common name: ** pantetheine *...") |
(Created page with "Category:Gene == Gene Tiso_gene_13367 == * right end position: ** 2108 * transcription direction: ** POSITIVE * left end position: ** 478 * centisome position: ** 7.531117...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13367 == |
− | * | + | * right end position: |
− | ** | + | ** 2108 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 478 |
− | * | + | * centisome position: |
− | ** | + | ** 7.531117 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.3.99.23-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-8042]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6475]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2108}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=478}} | |
− | + | {{#set: centisome position=7.531117 }} | |
− | + | {{#set: reaction associated=1.3.99.23-RXN|RXN-8042}} | |
− | + | {{#set: pathway associated=PWY-6475}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Gene Tiso_gene_13367
- right end position:
- 2108
- transcription direction:
- POSITIVE
- left end position:
- 478
- centisome position:
- 7.531117
- Synonym(s):
Reactions associated
- Reaction: 1.3.99.23-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-8042
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation