Difference between revisions of "CPD-9007"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTUP UTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** UTP:uridine 5'-phosphotransferase * S...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTUP UTUP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O
 
* common name:
 
* common name:
−
** UTP:uridine 5'-phosphotransferase
+
** ADP ribose 1'',2''-cyclic phosphate
 +
* inchi key:
 +
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
 +
* molecular weight:
 +
** 618.26   
 
* Synonym(s):
 
* Synonym(s):
 +
** ADP ribose 1''-2''-cyclic phosphate
 +
** ADP ribose 1'',2''-phosphate
 +
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
 +
** Appr>p
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[URIDINE]][c] '''+''' 1.0 [[UTP]][c] '''=>''' 1.0 [[UMP]][c] '''+''' 1.0 [[UDP]][c] '''+''' 1.0 [[PROTON]][c]
+
* [[2.7.1.160-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 uridine[c] '''+''' 1.0 UTP[c] '''=>''' 1.0 UMP[c] '''+''' 1.0 UDP[c] '''+''' 1.0 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20134]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_14474]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=UTP:uridine 5'-phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
−
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
 +
{{#set: molecular weight=618.26    }}
 +
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
 +
{{#set: produced by=2.7.1.160-RXN}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-9007

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O
  • common name:
    • ADP ribose 1,2-cyclic phosphate
  • inchi key:
    • InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
  • molecular weight:
    • 618.26
  • Synonym(s):
    • ADP ribose 1-2-cyclic phosphate
    • ADP ribose 1,2-phosphate
    • adenosine diphosphate ribose 1,2-cyclic phosphate
    • Appr>p

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O" cannot be used as a page name in this wiki.


"Appr>p" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9007&oldid=47466"