Difference between revisions of "Tiso gene 1840"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * common name: ** 4-methylumbel...") |
(Created page with "Category:Gene == Gene Tiso_gene_1840 == * right end position: ** 12232 * transcription direction: ** NEGATIVE * left end position: ** 9589 * centisome position: ** 44.5337...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1840 == |
− | * | + | * right end position: |
− | ** | + | ** 12232 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 9589 |
− | * | + | * centisome position: |
− | ** | + | ** 44.53372 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.3.16-RXN]] | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12232}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=9589}} | |
− | + | {{#set: centisome position=44.53372 }} | |
− | + | {{#set: reaction associated=3.1.3.16-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:17, 21 March 2018
Gene Tiso_gene_1840
- right end position:
- 12232
- transcription direction:
- NEGATIVE
- left end position:
- 9589
- centisome position:
- 44.53372
- Synonym(s):
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation