Difference between revisions of "CPD-10813"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** 3,3',5'-triiodo-L-thyronine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 650.978 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** reverse triiodothyronine |
| − | ** | + | ** rT3 |
| − | + | ** triiodothyronine, reverse | |
| + | ** 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine | ||
| + | ** O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10604]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123465 44123465] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57261 57261] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57261 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07639 C07639] |
| − | {{#set: molecular weight= | + | {{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O}} |
| − | {{#set: common name= | + | {{#set: common name=3,3',5'-triiodo-L-thyronine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N}} |
| + | {{#set: molecular weight=650.978 }} | ||
| + | {{#set: common name=reverse triiodothyronine|rT3|triiodothyronine, reverse|4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine|O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine}} | ||
| + | {{#set: consumed by=RXN-10604}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-10813
- smiles:
- C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
- common name:
- 3,3',5'-triiodo-L-thyronine
- inchi key:
- InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
- molecular weight:
- 650.978
- Synonym(s):
- reverse triiodothyronine
- rT3
- triiodothyronine, reverse
- 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
- O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O" cannot be used as a page name in this wiki.
