Difference between revisions of "Tiso gene 12190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_12190 == * right end position: ** 6350 * transcription direction: ** NEGATIVE * left end position: ** 4212 * centisome position: ** 58.2492...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Gene Tiso_gene_12190 ==
* smiles:
+
* right end position:
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** 6350
* inchi key:
+
* transcription direction:
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
+
** NEGATIVE
* common name:
+
* left end position:
** (R)-NADHX
+
** 4212
* molecular weight:
+
* centisome position:
** 681.445    
+
** 58.249207    
 
* Synonym(s):
 
* Synonym(s):
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLUCURONOKINASE-RXN]]
* [[RXN-12754]]
+
** Source: [[annotation-experimental_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-4841]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=6350}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=4212}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
+
{{#set: centisome position=58.249207   }}
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
{{#set: reaction associated=GLUCURONOKINASE-RXN}}
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
+
{{#set: pathway associated=PWY-4841}}
{{#set: common name=(R)-NADHX}}
+
{{#set: molecular weight=681.445   }}
+
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
{{#set: produced by=RXN-12754}}
+

Latest revision as of 20:17, 21 March 2018

Gene Tiso_gene_12190

  • right end position:
    • 6350
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4212
  • centisome position:
    • 58.249207
  • Synonym(s):

Reactions associated

Pathways associated

External links