Difference between revisions of "RXN-15881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] == * direction: ** LEFT-TO-RIGHT * common name: ** cysteine_desulfurase_for_ir...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
+
 
* common name:
 
* common name:
−
** docosahexaenoate
+
** cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
−
* molecular weight:
+
** cysteine_mitochondrial
−
** 327.486   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** docosahexaenoic acid
 
−
** DHA
 
−
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-16138]]
+
** 1 [[CYS]][c] '''+''' 1 [[L-Cysteine-Desulfurases]][c] '''=>''' 1 [[Persulfurated-L-cysteine-desulfurases]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c]
−
* [[RXN-16017]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 L-cysteine[c] '''+''' 1 an [L-cysteine desulfurase][c] '''=>''' 1 an S-sulfanyl-[L-cysteine desulfurase][c] '''+''' 1 L-alanine[c]
−
* [[RXN-16063]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11478]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14710]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4284]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMFA01030185
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
+
{{#set: common name=cysteine_mitochondrial}}
−
* DRUGBANK : DB03756
+
{{#set: ec number=EC-2.8.1.7}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_11478|Tiso_gene_14710|Tiso_gene_4284}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
+
{{#set: in pathway=PWY-7250}}
−
* HMDB : HMDB02183
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=docosahexaenoate}}
+
−
{{#set: molecular weight=327.486    }}
+
−
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
+
−
{{#set: produced by=RXN-16138|RXN-16017}}
+
−
{{#set: consumed or produced by=RXN-16063}}
+

Latest revision as of 20:17, 21 March 2018

Reaction RXN-15881

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
    • cysteine_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
    • 10 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15881&oldid=47488"