Difference between revisions of "TransportSeed F-"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_F- TransportSeed_F-] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Form...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_F- TransportSeed_F-] ==
* smiles:
+
* direction:
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
* common name:
+
** 2-hydroxy-dATP
+
* molecular weight:
+
** 503.152   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
 
** 2'-deoxyisoguanosine triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14290]]
+
** 1.0 [[F-]][e] '''=>''' 1.0 [[F-]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 fluoride[e] '''=>''' 1.0 fluoride[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=manual}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}}
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
{{#set: common name=2-hydroxy-dATP}}
+
{{#set: molecular weight=503.152    }}
+
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
{{#set: produced by=RXN-14290}}
+

Latest revision as of 20:17, 21 March 2018

Reaction TransportSeed_F-

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
    • 1.0 F-[e] => 1.0 F-[c]
  • With common name(s):
    • 1.0 fluoride[e] => 1.0 fluoride[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links